C15H26N2O5 — CID 155879332
[(3aR,7S,7aR)-2-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone;formic acid (PubChem CID 155879332) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(3aR,7S,7aR)-2-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone;formic acid.
| Compound Name | [(3aR,7S,7aR)-2-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone;formic acid |
|---|---|
| PubChem CID | 155879332 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | [(3aR,7S,7aR)-2-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(1,2-oxazolidin-2-yl)methanone;formic acid |
| SMILES | CC(C)N1C[C@@H]2COC[C@@H](C(=O)N3CCCO3)[C@@H]2C1.O=CO |
| InChI | InChI=1S/C14H24N2O3.CH2O2/c1-10(2)15-6-11-8-18-9-13(12(11)7-15)14(17)16-4-3-5-19-16;2-1-3/h10-13H,3-9H2,1-2H3;1H,(H,2,3)/t11-,12-,13-;/m1./s1 |
| InChIKey | MTXZRPVVHBGHQB-NLPVPVDASA-N |
| XLogP | 0.45 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|