C23H31ClN2O — CID 15589189
1-butyl-1-[1-(2-chlorophenyl)ethyl]-3-(2-phenylbutan-2-yl)urea (PubChem CID 15589189) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is 1-butyl-1-[1-(2-chlorophenyl)ethyl]-3-(2-phenylbutan-2-yl)urea.
| Compound Name | 1-butyl-1-[1-(2-chlorophenyl)ethyl]-3-(2-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 15589189 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-butyl-1-[1-(2-chlorophenyl)ethyl]-3-(2-phenylbutan-2-yl)urea |
| SMILES | CCCCN(C(=O)NC(C)(CC)c1ccccc1)C(C)c1ccccc1Cl |
| InChI | InChI=1S/C23H31ClN2O/c1-5-7-17-26(18(3)20-15-11-12-16-21(20)24)22(27)25-23(4,6-2)19-13-9-8-10-14-19/h8-16,18H,5-7,17H2,1-4H3,(H,25,27) |
| InChIKey | YHCNZWZYNPSRNB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |