C14H19Cl2N3O3 — CID 90715068
butyl-[2-(carbamoylamino)-1-(2,3-dichlorophenyl)ethyl]carbamic acid (PubChem CID 90715068) has the molecular formula C14H19Cl2N3O3 and a molecular weight of 348.23 g/mol. Its IUPAC name is butyl-[2-(carbamoylamino)-1-(2,3-dichlorophenyl)ethyl]carbamic acid.
| Compound Name | butyl-[2-(carbamoylamino)-1-(2,3-dichlorophenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 90715068 |
| Molecular Formula | C14H19Cl2N3O3 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | butyl-[2-(carbamoylamino)-1-(2,3-dichlorophenyl)ethyl]carbamic acid |
| SMILES | CCCCN(C(=O)O)C(CNC(N)=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H19Cl2N3O3/c1-2-3-7-19(14(21)22)11(8-18-13(17)20)9-5-4-6-10(15)12(9)16/h4-6,11H,2-3,7-8H2,1H3,(H,21,22)(H3,17,18,20) |
| InChIKey | GKEQHHVMJNLNON-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |