C9H14F2O — CID 155893433
(2,2-difluorospiro[2.5]octan-7-yl)methanol (PubChem CID 155893433) has the molecular formula C9H14F2O and a molecular weight of 176.21 g/mol. Its IUPAC name is (2,2-difluorospiro[2.5]octan-7-yl)methanol.
| Compound Name | (2,2-difluorospiro[2.5]octan-7-yl)methanol |
|---|---|
| PubChem CID | 155893433 |
| Molecular Formula | C9H14F2O |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2,2-difluorospiro[2.5]octan-7-yl)methanol |
| SMILES | OCC1CCCC2(C1)CC2(F)F |
| InChI | InChI=1S/C9H14F2O/c10-9(11)6-8(9)3-1-2-7(4-8)5-12/h7,12H,1-6H2 |
| InChIKey | FXOAWPMHWFICDO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |