C8H10O3 — CID 155893522
2-(4-ethylidene-5-oxooxolan-3-yl)acetaldehyde (PubChem CID 155893522) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-(4-ethylidene-5-oxooxolan-3-yl)acetaldehyde.
| Compound Name | 2-(4-ethylidene-5-oxooxolan-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 155893522 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-(4-ethylidene-5-oxooxolan-3-yl)acetaldehyde |
| SMILES | CC=C1C(=O)OCC1CC=O |
| InChI | InChI=1S/C8H10O3/c1-2-7-6(3-4-9)5-11-8(7)10/h2,4,6H,3,5H2,1H3 |
| InChIKey | KKHYJKATIMBATC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|