C11H20N4O5 — CID 155902444
(5R,6R,7S,8R,8aS)-2-(3-aminopropylimino)-6,7,8-trihydroxy-5-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one (PubChem CID 155902444) has the molecular formula C11H20N4O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (5R,6R,7S,8R,8aS)-2-(3-aminopropylimino)-6,7,8-trihydroxy-5-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one.
| Compound Name | (5R,6R,7S,8R,8aS)-2-(3-aminopropylimino)-6,7,8-trihydroxy-5-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one |
|---|---|
| PubChem CID | 155902444 |
| Molecular Formula | C11H20N4O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (5R,6R,7S,8R,8aS)-2-(3-aminopropylimino)-6,7,8-trihydroxy-5-(hydroxymethyl)-1,5,6,7,8,8a-hexahydroimidazo[1,2-a]pyridin-3-one |
| SMILES | NCCC/N=C1\N[C@@H]2[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)N2C1=O |
| InChI | InChI=1S/C11H20N4O5/c12-2-1-3-13-9-11(20)15-5(4-16)6(17)7(18)8(19)10(15)14-9/h5-8,10,16-19H,1-4,12H2,(H,13,14)/t5-,6-,7+,8+,10+/m1/s1 |
| InChIKey | CZTFXOVKDOTBPJ-XAVNFNALSA-N |
| XLogP | -4.05 |
| TPSA | 151.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|