C13H19N3O2S — CID 155902757
(3aR,8aR)-2-(pyridin-3-ylmethyl)-3,3a,4,5,6,7,8,8a-octahydro-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide (PubChem CID 155902757) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is (3aR,8aR)-2-(pyridin-3-ylmethyl)-3,3a,4,5,6,7,8,8a-octahydro-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide.
| Compound Name | (3aR,8aR)-2-(pyridin-3-ylmethyl)-3,3a,4,5,6,7,8,8a-octahydro-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
|---|---|
| PubChem CID | 155902757 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (3aR,8aR)-2-(pyridin-3-ylmethyl)-3,3a,4,5,6,7,8,8a-octahydro-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
| SMILES | O=S1(=O)[C@@H]2CCNCC[C@@H]2CN1Cc1cccnc1 |
| InChI | InChI=1S/C13H19N3O2S/c17-19(18)13-4-7-14-6-3-12(13)10-16(19)9-11-2-1-5-15-8-11/h1-2,5,8,12-14H,3-4,6-7,9-10H2/t12-,13-/m1/s1 |
| InChIKey | HEYAPQUGJDVUMN-CHWSQXEVSA-N |
| XLogP | 0.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |