C9H10O7 — CID 155902964
(2E,4E)-2,4-dihydroxy-6-oxonona-2,4-dienedioic acid (PubChem CID 155902964) has the molecular formula C9H10O7 and a molecular weight of 230.17 g/mol. Its IUPAC name is (2E,4E)-2,4-dihydroxy-6-oxonona-2,4-dienedioic acid.
| Compound Name | (2E,4E)-2,4-dihydroxy-6-oxonona-2,4-dienedioic acid |
|---|---|
| PubChem CID | 155902964 |
| Molecular Formula | C9H10O7 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (2E,4E)-2,4-dihydroxy-6-oxonona-2,4-dienedioic acid |
| SMILES | O=C(O)CCC(=O)/C=C(O)\C=C(\O)C(=O)O |
| InChI | InChI=1S/C9H10O7/c10-5(1-2-8(13)14)3-6(11)4-7(12)9(15)16/h3-4,11-12H,1-2H2,(H,13,14)(H,15,16)/b6-3+,7-4+ |
| InChIKey | QHBMYQSLHKBMNK-XOKGJFMYSA-N |
| XLogP | 0.39 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|