C6H12ClNO — CID 155905538
(2S,3S)-2-ethenyloxolan-3-amine;hydrochloride (PubChem CID 155905538) has the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. Its IUPAC name is (2S,3S)-2-ethenyloxolan-3-amine;hydrochloride.
| Compound Name | (2S,3S)-2-ethenyloxolan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 155905538 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | (2S,3S)-2-ethenyloxolan-3-amine;hydrochloride |
| SMILES | C=C[C@@H]1OCC[C@@H]1N.Cl |
| InChI | InChI=1S/C6H11NO.ClH/c1-2-6-5(7)3-4-8-6;/h2,5-6H,1,3-4,7H2;1H/t5-,6-;/m0./s1 |
| InChIKey | BWAQJMHAMWXPKL-GEMLJDPKSA-N |
| XLogP | 0.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|