C27H33N3O2S — CID 155907111
ethyl 1-[2-(benzylcarbamothioyl)hydrazinyl]spiro[4H-naphthalene-3,1'-cycloheptane]-2-carboxylate (PubChem CID 155907111) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is ethyl 1-[2-(benzylcarbamothioyl)hydrazinyl]spiro[4H-naphthalene-3,1'-cycloheptane]-2-carboxylate.
| Compound Name | ethyl 1-[2-(benzylcarbamothioyl)hydrazinyl]spiro[4H-naphthalene-3,1'-cycloheptane]-2-carboxylate |
|---|---|
| PubChem CID | 155907111 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | ethyl 1-[2-(benzylcarbamothioyl)hydrazinyl]spiro[4H-naphthalene-3,1'-cycloheptane]-2-carboxylate |
| SMILES | CCOC(=O)C1=C(NNC(=S)NCc2ccccc2)c2ccccc2CC12CCCCCC2 |
| InChI | InChI=1S/C27H33N3O2S/c1-2-32-25(31)23-24(29-30-26(33)28-19-20-12-6-5-7-13-20)22-15-9-8-14-21(22)18-27(23)16-10-3-4-11-17-27/h5-9,12-15,29H,2-4,10-11,16-19H2,1H3,(H2,28,30,33) |
| InChIKey | SFONWVJCONNRQL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|