C23H24N2O2 — CID 2206611
(3Z)-N-benzyl-2-oxo-3-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylidenepropanamide (PubChem CID 2206611) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (3Z)-N-benzyl-2-oxo-3-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylidenepropanamide.
| Compound Name | (3Z)-N-benzyl-2-oxo-3-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylidenepropanamide |
|---|---|
| PubChem CID | 2206611 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (3Z)-N-benzyl-2-oxo-3-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylidenepropanamide |
| SMILES | O=C(/C=C1\NC2(CCCC2)Cc2ccccc21)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c26-21(22(27)24-16-17-8-2-1-3-9-17)14-20-19-11-5-4-10-18(19)15-23(25-20)12-6-7-13-23/h1-5,8-11,14,25H,6-7,12-13,15-16H2,(H,24,27)/b20-14- |
| InChIKey | DZRNRQYJSUWQQQ-ZHZULCJRSA-N |
| XLogP | 3.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|