C23H23NO3 — CID 10155501
(1Z)-1-phenacylidenespiro[2,4-dihydroisoquinoline-3,4'-cyclohexane]-1'-carboxylic acid (PubChem CID 10155501) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (1Z)-1-phenacylidenespiro[2,4-dihydroisoquinoline-3,4'-cyclohexane]-1'-carboxylic acid.
| Compound Name | (1Z)-1-phenacylidenespiro[2,4-dihydroisoquinoline-3,4'-cyclohexane]-1'-carboxylic acid |
|---|---|
| PubChem CID | 10155501 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (1Z)-1-phenacylidenespiro[2,4-dihydroisoquinoline-3,4'-cyclohexane]-1'-carboxylic acid |
| SMILES | O=C(/C=C1\NC2(CCC(C(=O)O)CC2)Cc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3/c25-21(16-6-2-1-3-7-16)14-20-19-9-5-4-8-18(19)15-23(24-20)12-10-17(11-13-23)22(26)27/h1-9,14,17,24H,10-13,15H2,(H,26,27)/b20-14- |
| InChIKey | CNRIIRBKLVXNPC-ZHZULCJRSA-N |
| XLogP | 4.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|