C25H26N2O3S — CID 2258992
ethyl 1-(benzoylcarbamothioylamino)spiro[4H-naphthalene-3,1'-cyclopentane]-2-carboxylate (PubChem CID 2258992) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is ethyl 1-(benzoylcarbamothioylamino)spiro[4H-naphthalene-3,1'-cyclopentane]-2-carboxylate.
| Compound Name | ethyl 1-(benzoylcarbamothioylamino)spiro[4H-naphthalene-3,1'-cyclopentane]-2-carboxylate |
|---|---|
| PubChem CID | 2258992 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | ethyl 1-(benzoylcarbamothioylamino)spiro[4H-naphthalene-3,1'-cyclopentane]-2-carboxylate |
| SMILES | CCOC(=O)C1=C(NC(=S)NC(=O)c2ccccc2)c2ccccc2CC12CCCC2 |
| InChI | InChI=1S/C25H26N2O3S/c1-2-30-23(29)20-21(26-24(31)27-22(28)17-10-4-3-5-11-17)19-13-7-6-12-18(19)16-25(20)14-8-9-15-25/h3-7,10-13H,2,8-9,14-16H2,1H3,(H2,26,27,28,31) |
| InChIKey | KOKJHNLVAHSLKW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|