C28H20N2O3 — CID 155907112
5-(2,7-dihydroxynaphthalen-1-yl)-9,10-dimethyl-7H-benzo[a]phenazin-2-one (PubChem CID 155907112) has the molecular formula C28H20N2O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-(2,7-dihydroxynaphthalen-1-yl)-9,10-dimethyl-7H-benzo[a]phenazin-2-one.
| Compound Name | 5-(2,7-dihydroxynaphthalen-1-yl)-9,10-dimethyl-7H-benzo[a]phenazin-2-one |
|---|---|
| PubChem CID | 155907112 |
| Molecular Formula | C28H20N2O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 5-(2,7-dihydroxynaphthalen-1-yl)-9,10-dimethyl-7H-benzo[a]phenazin-2-one |
| SMILES | Cc1cc2nc3c(cc(-c4c(O)ccc5ccc(O)cc45)c4ccc(=O)cc43)[nH]c2cc1C |
| InChI | InChI=1S/C28H20N2O3/c1-14-9-23-24(10-15(14)2)30-28-22-12-18(32)6-7-19(22)21(13-25(28)29-23)27-20-11-17(31)5-3-16(20)4-8-26(27)33/h3-13,29,31,33H,1-2H3 |
| InChIKey | WFHQSDHOFPMJKU-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|