C19H28N4O3S — CID 155913230
(6S,7S,8aS)-6-(2-methylpropyl)-4-oxo-N-propan-2-yl-2-(1,3-thiazole-4-carbonyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 155913230) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is (6S,7S,8aS)-6-(2-methylpropyl)-4-oxo-N-propan-2-yl-2-(1,3-thiazole-4-carbonyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (6S,7S,8aS)-6-(2-methylpropyl)-4-oxo-N-propan-2-yl-2-(1,3-thiazole-4-carbonyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 155913230 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | (6S,7S,8aS)-6-(2-methylpropyl)-4-oxo-N-propan-2-yl-2-(1,3-thiazole-4-carbonyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(C)C[C@H]1[C@@H](C(=O)NC(C)C)C[C@H]2CN(C(=O)c3cscn3)CC(=O)N21 |
| InChI | InChI=1S/C19H28N4O3S/c1-11(2)5-16-14(18(25)21-12(3)4)6-13-7-22(8-17(24)23(13)16)19(26)15-9-27-10-20-15/h9-14,16H,5-8H2,1-4H3,(H,21,25)/t13-,14-,16-/m0/s1 |
| InChIKey | JDHMSSOCWPKQKB-DZKIICNBSA-N |
| XLogP | 1.76 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |