C21H23N5O2S — CID 155917182
N-(3-phenylpropyl)-7-(1,3-thiazole-4-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide (PubChem CID 155917182) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is N-(3-phenylpropyl)-7-(1,3-thiazole-4-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide.
| Compound Name | N-(3-phenylpropyl)-7-(1,3-thiazole-4-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 155917182 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(3-phenylpropyl)-7-(1,3-thiazole-4-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1cn2c(n1)CCN(C(=O)c1cscn1)CC2 |
| InChI | InChI=1S/C21H23N5O2S/c27-20(22-9-4-7-16-5-2-1-3-6-16)17-13-26-12-11-25(10-8-19(26)24-17)21(28)18-14-29-15-23-18/h1-3,5-6,13-15H,4,7-12H2,(H,22,27) |
| InChIKey | FNXYDOOGKHROJH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|