C16H14FNO2 — CID 155920785
methyl 4-(3-fluorophenyl)-2,3-dihydro-1H-indole-6-carboxylate (PubChem CID 155920785) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is methyl 4-(3-fluorophenyl)-2,3-dihydro-1H-indole-6-carboxylate.
| Compound Name | methyl 4-(3-fluorophenyl)-2,3-dihydro-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 155920785 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 4-(3-fluorophenyl)-2,3-dihydro-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1cc2c(c(-c3cccc(F)c3)c1)CCN2 |
| InChI | InChI=1S/C16H14FNO2/c1-20-16(19)11-8-14(10-3-2-4-12(17)7-10)13-5-6-18-15(13)9-11/h2-4,7-9,18H,5-6H2,1H3 |
| InChIKey | SJRRWAVDQIYEMV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |