C10H16F3N2O14P3 — CID 155922389
[[(2S,3S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 155922389) has the molecular formula C10H16F3N2O14P3 and a molecular weight of 538.15 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 155922389 |
| Molecular Formula | C10H16F3N2O14P3 |
| Molecular Weight | 538.15 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-2,4-difluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C1CCN([C@@H]2O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@]2(F)CF)C(=O)N1 |
| InChI | InChI=1S/C10H16F3N2O14P3/c11-3-9(12)6(17)10(13,27-7(9)15-2-1-5(16)14-8(15)18)4-26-31(22,23)29-32(24,25)28-30(19,20)21/h6-7,17H,1-4H2,(H,22,23)(H,24,25)(H,14,16,18)(H2,19,20,21)/t6-,7+,9+,10+/m0/s1 |
| InChIKey | ZPVVCDNUNPWEBP-MVHNUAHISA-N |
| XLogP | -0.67 |
| TPSA | 238.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|