C16H20FN2O8P — CID 156594010
[(2R,3R,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate (PubChem CID 156594010) has the molecular formula C16H20FN2O8P and a molecular weight of 418.31 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 156594010 |
| Molecular Formula | C16H20FN2O8P |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](COP(=O)(O)Oc2ccccc2)O[C@H]1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C16H20FN2O8P/c1-16(17)13(21)11(26-14(16)19-8-7-12(20)18-15(19)22)9-25-28(23,24)27-10-5-3-2-4-6-10/h2-6,11,13-14,21H,7-9H2,1H3,(H,23,24)(H,18,20,22)/t11-,13-,14-,16-/m1/s1 |
| InChIKey | GCZHCATZGVGVBZ-XKVFNRALSA-N |
| XLogP | 0.94 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|