C21H21N3O3 — CID 155925004
N-(3,5-dimethylphenyl)-N'-(6-methoxy-2-methylquinolin-4-yl)oxamide (PubChem CID 155925004) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N'-(6-methoxy-2-methylquinolin-4-yl)oxamide.
| Compound Name | N-(3,5-dimethylphenyl)-N'-(6-methoxy-2-methylquinolin-4-yl)oxamide |
|---|---|
| PubChem CID | 155925004 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N'-(6-methoxy-2-methylquinolin-4-yl)oxamide |
| SMILES | COc1ccc2nc(C)cc(NC(=O)C(=O)Nc3cc(C)cc(C)c3)c2c1 |
| InChI | InChI=1S/C21H21N3O3/c1-12-7-13(2)9-15(8-12)23-20(25)21(26)24-19-10-14(3)22-18-6-5-16(27-4)11-17(18)19/h5-11H,1-4H3,(H,23,25)(H,22,24,26) |
| InChIKey | ZQEOFPMBXWNVSB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|