C20H16N4O7S2 — CID 155927344
4-hydroxy-6-methyl-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]chromene-3-sulfonamide (PubChem CID 155927344) has the molecular formula C20H16N4O7S2 and a molecular weight of 488.50 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]chromene-3-sulfonamide.
| Compound Name | 4-hydroxy-6-methyl-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]chromene-3-sulfonamide |
|---|---|
| PubChem CID | 155927344 |
| Molecular Formula | C20H16N4O7S2 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 4-hydroxy-6-methyl-2-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]chromene-3-sulfonamide |
| SMILES | Cc1ccc2oc(=O)c(S(=O)(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)c(O)c2c1 |
| InChI | InChI=1S/C20H16N4O7S2/c1-12-3-8-16-15(11-12)17(25)18(19(26)31-16)33(29,30)23-13-4-6-14(7-5-13)32(27,28)24-20-21-9-2-10-22-20/h2-11,23,25H,1H3,(H,21,22,24) |
| InChIKey | FLLOBIVYZOVRMZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 168.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|