C22H13BrO6 — CID 155928253
1'-(2-bromoacetyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 155928253) has the molecular formula C22H13BrO6 and a molecular weight of 453.24 g/mol. Its IUPAC name is 1'-(2-bromoacetyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 1'-(2-bromoacetyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 155928253 |
| Molecular Formula | C22H13BrO6 |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 1'-(2-bromoacetyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)cc(C(=O)CBr)c32)c2ccccc21 |
| InChI | InChI=1S/C22H13BrO6/c23-10-17(26)14-7-12(25)9-19-20(14)22(16-6-5-11(24)8-18(16)28-19)15-4-2-1-3-13(15)21(27)29-22/h1-9,24-25H,10H2 |
| InChIKey | KHUFZCKURBOXRS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|