C20H13NO6 — CID 165403619
3',6'-dihydroxy-1'-(hydroxyamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 165403619) has the molecular formula C20H13NO6 and a molecular weight of 363.33 g/mol. Its IUPAC name is 3',6'-dihydroxy-1'-(hydroxyamino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-1'-(hydroxyamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 165403619 |
| Molecular Formula | C20H13NO6 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3',6'-dihydroxy-1'-(hydroxyamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)cc(NO)c32)c2ccccc21 |
| InChI | InChI=1S/C20H13NO6/c22-10-5-6-14-16(8-10)26-17-9-11(23)7-15(21-25)18(17)20(14)13-4-2-1-3-12(13)19(24)27-20/h1-9,21-23,25H |
| InChIKey | WIKVJCAKOSJALY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|