C22H22ClN5O5S — CID 155929104
(2R)-2-acetamido-3-[3-[[4-(3-chloro-4-hydroxyanilino)quinazolin-6-yl]amino]-3-oxopropyl]sulfanylpropanoic acid (PubChem CID 155929104) has the molecular formula C22H22ClN5O5S and a molecular weight of 503.97 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[3-[[4-(3-chloro-4-hydroxyanilino)quinazolin-6-yl]amino]-3-oxopropyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[3-[[4-(3-chloro-4-hydroxyanilino)quinazolin-6-yl]amino]-3-oxopropyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 155929104 |
| Molecular Formula | C22H22ClN5O5S |
| Molecular Weight | 503.97 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | (2R)-2-acetamido-3-[3-[[4-(3-chloro-4-hydroxyanilino)quinazolin-6-yl]amino]-3-oxopropyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSCCC(=O)Nc1ccc2ncnc(Nc3ccc(O)c(Cl)c3)c2c1)C(=O)O |
| InChI | InChI=1S/C22H22ClN5O5S/c1-12(29)26-18(22(32)33)10-34-7-6-20(31)27-13-2-4-17-15(8-13)21(25-11-24-17)28-14-3-5-19(30)16(23)9-14/h2-5,8-9,11,18,30H,6-7,10H2,1H3,(H,26,29)(H,27,31)(H,32,33)(H,24,25,28)/t18-/m0/s1 |
| InChIKey | ZVLOBPAXNJDPJR-SFHVURJKSA-N |
| XLogP | 3.38 |
| TPSA | 153.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.97 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|