C14H17N — CID 155931583
4-but-3-enyl-1-methyl-3,4-dihydroisoquinoline (PubChem CID 155931583) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-but-3-enyl-1-methyl-3,4-dihydroisoquinoline.
| Compound Name | 4-but-3-enyl-1-methyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 155931583 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 4-but-3-enyl-1-methyl-3,4-dihydroisoquinoline |
| SMILES | C=CCCC1CN=C(C)c2ccccc21 |
| InChI | InChI=1S/C14H17N/c1-3-4-7-12-10-15-11(2)13-8-5-6-9-14(12)13/h3,5-6,8-9,12H,1,4,7,10H2,2H3 |
| InChIKey | KLJJREPQGGSVJM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|