C19H40O2Si2 — CID 155931948
tert-butyl-[(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-yn-3-yl]oxy-dimethylsilane (PubChem CID 155931948) has the molecular formula C19H40O2Si2 and a molecular weight of 356.70 g/mol. Its IUPAC name is tert-butyl-[(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-yn-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-yn-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 155931948 |
| Molecular Formula | C19H40O2Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | tert-butyl-[(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-yn-3-yl]oxy-dimethylsilane |
| SMILES | C#CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O2Si2/c1-13-15-17(21-23(11,12)19(6,7)8)16(14-2)20-22(9,10)18(3,4)5/h1,16-17H,14-15H2,2-12H3/t16-,17-/m0/s1 |
| InChIKey | ZISNVZYCEDODQQ-IRXDYDNUSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|