C11H12F3NO3 — CID 155933661
(NE)-N-[2,2,2-trifluoro-1-[3-(methoxymethoxy)-4-methylphenyl]ethylidene]hydroxylamine (PubChem CID 155933661) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is (NE)-N-[2,2,2-trifluoro-1-[3-(methoxymethoxy)-4-methylphenyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2,2,2-trifluoro-1-[3-(methoxymethoxy)-4-methylphenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 155933661 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (NE)-N-[2,2,2-trifluoro-1-[3-(methoxymethoxy)-4-methylphenyl]ethylidene]hydroxylamine |
| SMILES | COCOc1cc(/C(=N\O)C(F)(F)F)ccc1C |
| InChI | InChI=1S/C11H12F3NO3/c1-7-3-4-8(5-9(7)18-6-17-2)10(15-16)11(12,13)14/h3-5,16H,6H2,1-2H3/b15-10+ |
| InChIKey | YMKRIANLVAQBTB-XNTDXEJSSA-N |
| XLogP | 2.72 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|