C16H19NO5S — CID 155934058
ethyl (3R)-3-benzoyl-4-methylidene-1-methylsulfonylpyrrolidine-3-carboxylate (PubChem CID 155934058) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is ethyl (3R)-3-benzoyl-4-methylidene-1-methylsulfonylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R)-3-benzoyl-4-methylidene-1-methylsulfonylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 155934058 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | ethyl (3R)-3-benzoyl-4-methylidene-1-methylsulfonylpyrrolidine-3-carboxylate |
| SMILES | C=C1CN(S(C)(=O)=O)C[C@@]1(C(=O)OCC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO5S/c1-4-22-15(19)16(14(18)13-8-6-5-7-9-13)11-17(10-12(16)2)23(3,20)21/h5-9H,2,4,10-11H2,1,3H3/t16-/m0/s1 |
| InChIKey | SRMAKRQKGFSZFY-INIZCTEOSA-N |
| XLogP | 1.25 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|