C23H27BO3 — CID 155936371
2,2-diphenyl-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)cyclobutan-1-one (PubChem CID 155936371) has the molecular formula C23H27BO3 and a molecular weight of 362.28 g/mol. Its IUPAC name is 2,2-diphenyl-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)cyclobutan-1-one.
| Compound Name | 2,2-diphenyl-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)cyclobutan-1-one |
|---|---|
| PubChem CID | 155936371 |
| Molecular Formula | C23H27BO3 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2,2-diphenyl-3-(4,4,6,6-tetramethyl-1,3,2-dioxaborinan-2-yl)cyclobutan-1-one |
| SMILES | CC1(C)CC(C)(C)OB(C2CC(=O)C2(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C23H27BO3/c1-21(2)16-22(3,4)27-24(26-21)19-15-20(25)23(19,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19H,15-16H2,1-4H3 |
| InChIKey | FDMNDCMAZXXCJR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|