C13H17O+ — CID 162435891
3,5,5-trimethyl-3-phenyl-2,4-dihydrofuran-2-ylium (PubChem CID 162435891) has the molecular formula C13H17O+ and a molecular weight of 189.28 g/mol. Its IUPAC name is 3,5,5-trimethyl-3-phenyl-2,4-dihydrofuran-2-ylium.
| Compound Name | 3,5,5-trimethyl-3-phenyl-2,4-dihydrofuran-2-ylium |
|---|---|
| PubChem CID | 162435891 |
| Molecular Formula | C13H17O+ |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3,5,5-trimethyl-3-phenyl-2,4-dihydrofuran-2-ylium |
| SMILES | CC1(C)CC(C)(c2ccccc2)[CH+]O1 |
| InChI | InChI=1S/C13H17O/c1-12(2)9-13(3,10-14-12)11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3/q+1 |
| InChIKey | QSCRHCUOPOMJNU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|