C15H18O2S — CID 155936372
4-(3-methylbutyl)-2-phenylsulfanyl-2H-furan-5-one (PubChem CID 155936372) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-(3-methylbutyl)-2-phenylsulfanyl-2H-furan-5-one.
| Compound Name | 4-(3-methylbutyl)-2-phenylsulfanyl-2H-furan-5-one |
|---|---|
| PubChem CID | 155936372 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-(3-methylbutyl)-2-phenylsulfanyl-2H-furan-5-one |
| SMILES | CC(C)CCC1=CC(Sc2ccccc2)OC1=O |
| InChI | InChI=1S/C15H18O2S/c1-11(2)8-9-12-10-14(17-15(12)16)18-13-6-4-3-5-7-13/h3-7,10-11,14H,8-9H2,1-2H3 |
| InChIKey | VJMJALKOSVFUMP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |