C17H22O4S — CID 135007414
1-O-ethyl 7-O-methyl (E,4R)-4-benzylsulfanylhept-2-enedioate (PubChem CID 135007414) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (E,4R)-4-benzylsulfanylhept-2-enedioate.
| Compound Name | 1-O-ethyl 7-O-methyl (E,4R)-4-benzylsulfanylhept-2-enedioate |
|---|---|
| PubChem CID | 135007414 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-O-ethyl 7-O-methyl (E,4R)-4-benzylsulfanylhept-2-enedioate |
| SMILES | CCOC(=O)/C=C/[C@@H](CCC(=O)OC)SCc1ccccc1 |
| InChI | InChI=1S/C17H22O4S/c1-3-21-17(19)12-10-15(9-11-16(18)20-2)22-13-14-7-5-4-6-8-14/h4-8,10,12,15H,3,9,11,13H2,1-2H3/b12-10+/t15-/m1/s1 |
| InChIKey | MMLXOPDRHZNFIH-HBIYDYFMSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|