C19H26O4 — CID 155936743
(2S,6S,7R)-6-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]-6,8-dimethyltricyclo[5.3.1.01,5]undec-8-ene-2-carboxylic acid (PubChem CID 155936743) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (2S,6S,7R)-6-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]-6,8-dimethyltricyclo[5.3.1.01,5]undec-8-ene-2-carboxylic acid.
| Compound Name | (2S,6S,7R)-6-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]-6,8-dimethyltricyclo[5.3.1.01,5]undec-8-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 155936743 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (2S,6S,7R)-6-[(E)-3-methoxy-2-methyl-3-oxoprop-1-enyl]-6,8-dimethyltricyclo[5.3.1.01,5]undec-8-ene-2-carboxylic acid |
| SMILES | COC(=O)/C(C)=C/[C@]1(C)C2CC[C@H](C(=O)O)C23CC=C(C)[C@H]1C3 |
| InChI | InChI=1S/C19H26O4/c1-11-7-8-19-10-14(11)18(3,9-12(2)17(22)23-4)15(19)6-5-13(19)16(20)21/h7,9,13-15H,5-6,8,10H2,1-4H3,(H,20,21)/b12-9+/t13-,14-,15?,18+,19?/m1/s1 |
| InChIKey | VSDGEOVQWOLFKV-VHWKVAABSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|