C17H19NO5 — CID 155949616
N-[[2-(2-hydroxyethoxy)phenyl]methyl]-2-(4-hydroxyphenoxy)acetamide (PubChem CID 155949616) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is N-[[2-(2-hydroxyethoxy)phenyl]methyl]-2-(4-hydroxyphenoxy)acetamide.
| Compound Name | N-[[2-(2-hydroxyethoxy)phenyl]methyl]-2-(4-hydroxyphenoxy)acetamide |
|---|---|
| PubChem CID | 155949616 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[[2-(2-hydroxyethoxy)phenyl]methyl]-2-(4-hydroxyphenoxy)acetamide |
| SMILES | O=C(COc1ccc(O)cc1)NCc1ccccc1OCCO |
| InChI | InChI=1S/C17H19NO5/c19-9-10-22-16-4-2-1-3-13(16)11-18-17(21)12-23-15-7-5-14(20)6-8-15/h1-8,19-20H,9-12H2,(H,18,21) |
| InChIKey | WGFRUQOUWMHUFL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |