C19H24ClN3O2S — CID 155950829
1-[1-(4-chlorophenyl)piperidin-4-yl]-3-(3-hydroxy-1-thiophen-2-ylpropyl)urea (PubChem CID 155950829) has the molecular formula C19H24ClN3O2S and a molecular weight of 393.94 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)piperidin-4-yl]-3-(3-hydroxy-1-thiophen-2-ylpropyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)piperidin-4-yl]-3-(3-hydroxy-1-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 155950829 |
| Molecular Formula | C19H24ClN3O2S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-[1-(4-chlorophenyl)piperidin-4-yl]-3-(3-hydroxy-1-thiophen-2-ylpropyl)urea |
| SMILES | O=C(NC1CCN(c2ccc(Cl)cc2)CC1)NC(CCO)c1cccs1 |
| InChI | InChI=1S/C19H24ClN3O2S/c20-14-3-5-16(6-4-14)23-10-7-15(8-11-23)21-19(25)22-17(9-12-24)18-2-1-13-26-18/h1-6,13,15,17,24H,7-12H2,(H2,21,22,25) |
| InChIKey | DTGRLJUMCQQKJR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |