C19H21FN2O4S — CID 155952127
N-[4-[[2-(3-fluorophenyl)acetyl]sulfamoyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 155952127) has the molecular formula C19H21FN2O4S and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[4-[[2-(3-fluorophenyl)acetyl]sulfamoyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[[2-(3-fluorophenyl)acetyl]sulfamoyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 155952127 |
| Molecular Formula | C19H21FN2O4S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[4-[[2-(3-fluorophenyl)acetyl]sulfamoyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(S(=O)(=O)NC(=O)Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H21FN2O4S/c1-19(2,3)18(24)21-15-7-9-16(10-8-15)27(25,26)22-17(23)12-13-5-4-6-14(20)11-13/h4-11H,12H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | GRKJVXLAFWPVEX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |