C20H19F3N4O6S — CID 155964127
N-(4-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155964127) has the molecular formula C20H19F3N4O6S and a molecular weight of 500.46 g/mol. Its IUPAC name is N-(4-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(4-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155964127 |
| Molecular Formula | C20H19F3N4O6S |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | N-(4-amino-1,2,3,4-tetrahydronaphthalen-1-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | NC1CCC(NS(=O)(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)c2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18N4O4S.C2HF3O2/c19-13-6-8-14(12-4-2-1-3-11(12)13)22-27(25,26)10-5-7-15-16(9-10)21-18(24)17(23)20-15;3-2(4,5)1(6)7/h1-5,7,9,13-14,22H,6,8,19H2,(H,20,23)(H,21,24);(H,6,7) |
| InChIKey | REPIUBOYLSIBEA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 175.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|