C17H21N3O7 — CID 155971719
formic acid;methyl 4-[[(1S,5R)-10-oxo-3-oxa-7,9-diazabicyclo[3.3.2]decane-7-carbonyl]amino]benzoate (PubChem CID 155971719) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is formic acid;methyl 4-[[(1S,5R)-10-oxo-3-oxa-7,9-diazabicyclo[3.3.2]decane-7-carbonyl]amino]benzoate.
| Compound Name | formic acid;methyl 4-[[(1S,5R)-10-oxo-3-oxa-7,9-diazabicyclo[3.3.2]decane-7-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 155971719 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | formic acid;methyl 4-[[(1S,5R)-10-oxo-3-oxa-7,9-diazabicyclo[3.3.2]decane-7-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N2C[C@H]3COC[C@@H](C2)C(=O)N3)cc1.O=CO |
| InChI | InChI=1S/C16H19N3O5.CH2O2/c1-23-15(21)10-2-4-12(5-3-10)18-16(22)19-6-11-8-24-9-13(7-19)17-14(11)20;2-1-3/h2-5,11,13H,6-9H2,1H3,(H,17,20)(H,18,22);1H,(H,2,3)/t11-,13+;/m1./s1 |
| InChIKey | MANIGBDOMBGAJK-YLAFAASESA-N |
| XLogP | 0.15 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|