C22H31N5O4 — CID 155972738
2-ethyl-N-[[(1S,5S,6R,7R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid (PubChem CID 155972738) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-ethyl-N-[[(1S,5S,6R,7R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid.
| Compound Name | 2-ethyl-N-[[(1S,5S,6R,7R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid |
|---|---|
| PubChem CID | 155972738 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-ethyl-N-[[(1S,5S,6R,7R)-3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide;formic acid |
| SMILES | CCC(CC)C(=O)NC[C@H]1[C@H]2CN(c3nnc4ccccn34)C[C@]23CC[C@H]1O3.O=CO |
| InChI | InChI=1S/C21H29N5O2.CH2O2/c1-3-14(4-2)19(27)22-11-15-16-12-25(13-21(16)9-8-17(15)28-21)20-24-23-18-7-5-6-10-26(18)20;2-1-3/h5-7,10,14-17H,3-4,8-9,11-13H2,1-2H3,(H,22,27);1H,(H,2,3)/t15-,16+,17+,21+;/m0./s1 |
| InChIKey | SSWZCNOEFPXLKK-QSFXVJEKSA-N |
| XLogP | 1.97 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|