sodium (3R)-oxolane-3-sulfinate

C4H7NaO3S — CID 155973008

IUPACsodium (3R)-oxolane-3-sulfinate
SMILESO=S([O-])[C@@H]1CCOC1.[Na+]
InChIInChI=1S/C4H8O3S.Na/c5-8(6)4-1-2-7-3-4;/h4H,1-3H2,(H,5,6);/q;+1/p-1/t4-;/m1./s1
InChIKeyIHAPRSZBTHYXPY-PGMHMLKASA-M
MW158.15 g/mol
LogP-3.34
Rot. Bonds1

About sodium (3R)-oxolane-3-sulfinate

sodium (3R)-oxolane-3-sulfinate (PubChem CID 155973008) has the molecular formula C4H7NaO3S and a molecular weight of 158.15 g/mol. Its IUPAC name is sodium (3R)-oxolane-3-sulfinate.

Molecular Properties

Compound Namesodium (3R)-oxolane-3-sulfinate
PubChem CID155973008
Molecular FormulaC4H7NaO3S
Molecular Weight158.15 g/mol
Exact Mass158.00
IUPAC Namesodium (3R)-oxolane-3-sulfinate
SMILESO=S([O-])[C@@H]1CCOC1.[Na+]
InChIInChI=1S/C4H8O3S.Na/c5-8(6)4-1-2-7-3-4;/h4H,1-3H2,(H,5,6);/q;+1/p-1/t4-;/m1./s1
InChIKeyIHAPRSZBTHYXPY-PGMHMLKASA-M
XLogP-3.34
TPSA49.36 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.15
LogP ≤ 5-3.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze sodium (3R)-oxolane-3-sulfinate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium (3R)-oxolane-3-sulfinate?
The IUPAC name of sodium (3R)-oxolane-3-sulfinate (CID 155973008) is sodium (3R)-oxolane-3-sulfinate.
What is the SMILES notation for sodium (3R)-oxolane-3-sulfinate?
The canonical SMILES for sodium (3R)-oxolane-3-sulfinate is O=S([O-])[C@@H]1CCOC1.[Na+].
What is the InChIKey of sodium (3R)-oxolane-3-sulfinate?
The InChIKey is IHAPRSZBTHYXPY-PGMHMLKASA-M. The full InChI is InChI=1S/C4H8O3S.Na/c5-8(6)4-1-2-7-3-4;/h4H,1-3H2,(H,5,6);/q;+1/p-1/t4-;/m1./s1.
What are the key properties of sodium (3R)-oxolane-3-sulfinate?
sodium (3R)-oxolane-3-sulfinate has a molecular weight of 158.15 g/mol, XLogP of -3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (3R)-oxolane-3-sulfinate is sourced from PubChem (CID 155973008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).