About sodium (3R)-oxolane-3-sulfinate
sodium (3R)-oxolane-3-sulfinate (PubChem CID 155973008) has the molecular formula C4H7NaO3S
and a molecular weight of 158.15 g/mol. Its IUPAC name is sodium (3R)-oxolane-3-sulfinate.
Molecular Properties
| Compound Name | sodium (3R)-oxolane-3-sulfinate |
| PubChem CID | 155973008 |
| Molecular Formula | C4H7NaO3S |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | sodium (3R)-oxolane-3-sulfinate |
| SMILES | O=S([O-])[C@@H]1CCOC1.[Na+] |
| InChI | InChI=1S/C4H8O3S.Na/c5-8(6)4-1-2-7-3-4;/h4H,1-3H2,(H,5,6);/q;+1/p-1/t4-;/m1./s1 |
| InChIKey | IHAPRSZBTHYXPY-PGMHMLKASA-M |
| XLogP | -3.34 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium (3R)-oxolane-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (3R)-oxolane-3-sulfinate?
The IUPAC name of sodium (3R)-oxolane-3-sulfinate (CID 155973008) is sodium (3R)-oxolane-3-sulfinate.
What is the SMILES notation for sodium (3R)-oxolane-3-sulfinate?
The canonical SMILES for sodium (3R)-oxolane-3-sulfinate is O=S([O-])[C@@H]1CCOC1.[Na+].
What is the InChIKey of sodium (3R)-oxolane-3-sulfinate?
The InChIKey is IHAPRSZBTHYXPY-PGMHMLKASA-M. The full InChI is InChI=1S/C4H8O3S.Na/c5-8(6)4-1-2-7-3-4;/h4H,1-3H2,(H,5,6);/q;+1/p-1/t4-;/m1./s1.
What are the key properties of sodium (3R)-oxolane-3-sulfinate?
sodium (3R)-oxolane-3-sulfinate has a molecular weight of 158.15 g/mol, XLogP of -3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (3R)-oxolane-3-sulfinate is sourced from PubChem (CID 155973008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).