C6H9BrO2 — CID 155973326
trans-(2R,3R)-1-bromo-2,3-dimethylcyclopropane-1-carboxylic acid (PubChem CID 155973326) has the molecular formula C6H9BrO2 and a molecular weight of 193.04 g/mol. Its IUPAC name is trans-(2R,3R)-1-bromo-2,3-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(2R,3R)-1-bromo-2,3-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155973326 |
| Molecular Formula | C6H9BrO2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | trans-(2R,3R)-1-bromo-2,3-dimethylcyclopropane-1-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](C)C1(Br)C(=O)O |
| InChI | InChI=1S/C6H9BrO2/c1-3-4(2)6(3,7)5(8)9/h3-4H,1-2H3,(H,8,9)/t3-,4-/m1/s1 |
| InChIKey | NSNQAZFCJXFXHY-QWWZWVQMSA-N |
| XLogP | 1.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|