C22H34N4O3S — CID 155979587
2-[(3S,3aR,4S,6aS)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1-(1,3-thiazol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-4-yl]-N,N-diethylacetamide (PubChem CID 155979587) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is 2-[(3S,3aR,4S,6aS)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1-(1,3-thiazol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-4-yl]-N,N-diethylacetamide.
| Compound Name | 2-[(3S,3aR,4S,6aS)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1-(1,3-thiazol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-4-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 155979587 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[(3S,3aR,4S,6aS)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1-(1,3-thiazol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-4-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C[C@@H]1OC[C@@H]2[C@H]1[C@H](CC(=O)N1CCCC1)CN2Cc1cncs1 |
| InChI | InChI=1S/C22H34N4O3S/c1-3-24(4-2)21(28)10-19-22-16(9-20(27)25-7-5-6-8-25)12-26(18(22)14-29-19)13-17-11-23-15-30-17/h11,15-16,18-19,22H,3-10,12-14H2,1-2H3/t16-,18-,19+,22-/m1/s1 |
| InChIKey | BXUDRYDRBOCELX-NSAZKJPHSA-N |
| XLogP | 2.23 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |