C15H18N2OS — CID 155980345
[2-(1,3-benzothiazol-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol (PubChem CID 155980345) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 155980345 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol |
| SMILES | OCC12CCCC1CN(c1nc3ccccc3s1)C2 |
| InChI | InChI=1S/C15H18N2OS/c18-10-15-7-3-4-11(15)8-17(9-15)14-16-12-5-1-2-6-13(12)19-14/h1-2,5-6,11,18H,3-4,7-10H2 |
| InChIKey | KZKWJOVEOWGOAL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |