C15H17ClN2O2S — CID 137345071
[(3aR,7aR)-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137345071) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is [(3aR,7aR)-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137345071 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | [(3aR,7aR)-2-(6-chloro-1,3-benzothiazol-2-yl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | OC[C@]12CCOC[C@H]1CN(c1nc3ccc(Cl)cc3s1)C2 |
| InChI | InChI=1S/C15H17ClN2O2S/c16-11-1-2-12-13(5-11)21-14(17-12)18-6-10-7-20-4-3-15(10,8-18)9-19/h1-2,5,10,19H,3-4,6-9H2/t10-,15-/m1/s1 |
| InChIKey | XHQJRYRBCVUZMV-MEBBXXQBSA-N |
| XLogP | 2.78 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |