C19H21N7OS — CID 155981248
2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-5-methoxy-1,3-benzothiazole (PubChem CID 155981248) has the molecular formula C19H21N7OS and a molecular weight of 395.49 g/mol. Its IUPAC name is 2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-5-methoxy-1,3-benzothiazole.
| Compound Name | 2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-5-methoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 155981248 |
| Molecular Formula | C19H21N7OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-5-methoxy-1,3-benzothiazole |
| SMILES | CCn1cnc2c(N3CCN(c4nc5cc(OC)ccc5s4)CC3)ncnc21 |
| InChI | InChI=1S/C19H21N7OS/c1-3-24-12-22-16-17(24)20-11-21-18(16)25-6-8-26(9-7-25)19-23-14-10-13(27-2)4-5-15(14)28-19/h4-5,10-12H,3,6-9H2,1-2H3 |
| InChIKey | FTHNEIVJQJHFST-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |