C18H18BrN7S — CID 155981269
6-bromo-2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 155981269) has the molecular formula C18H18BrN7S and a molecular weight of 444.36 g/mol. Its IUPAC name is 6-bromo-2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-bromo-2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 155981269 |
| Molecular Formula | C18H18BrN7S |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 6-bromo-2-[4-(9-ethylpurin-6-yl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | CCn1cnc2c(N3CCN(c4nc5ccc(Br)cc5s4)CC3)ncnc21 |
| InChI | InChI=1S/C18H18BrN7S/c1-2-24-11-22-15-16(24)20-10-21-17(15)25-5-7-26(8-6-25)18-23-13-4-3-12(19)9-14(13)27-18/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | YOXMZZRSXIRMRB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |