C24H26F2N2O4S — CID 155987306
(5E)-1'-(3,4-difluorophenyl)sulfonylspiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-8,4'-piperidine]-11-one (PubChem CID 155987306) has the molecular formula C24H26F2N2O4S and a molecular weight of 476.55 g/mol. Its IUPAC name is (5E)-1'-(3,4-difluorophenyl)sulfonylspiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-8,4'-piperidine]-11-one.
| Compound Name | (5E)-1'-(3,4-difluorophenyl)sulfonylspiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-8,4'-piperidine]-11-one |
|---|---|
| PubChem CID | 155987306 |
| Molecular Formula | C24H26F2N2O4S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (5E)-1'-(3,4-difluorophenyl)sulfonylspiro[2-oxa-10-azabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-8,4'-piperidine]-11-one |
| SMILES | O=C1NCC2(C/C=C/CCOc3ccccc31)CCN(S(=O)(=O)c1ccc(F)c(F)c1)CC2 |
| InChI | InChI=1S/C24H26F2N2O4S/c25-20-9-8-18(16-21(20)26)33(30,31)28-13-11-24(12-14-28)10-4-1-5-15-32-22-7-3-2-6-19(22)23(29)27-17-24/h1-4,6-9,16H,5,10-15,17H2,(H,27,29)/b4-1+ |
| InChIKey | KTIQLYAKNRCRRB-DAFODLJHSA-N |
| XLogP | 3.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|