C19H23FN2O2 — CID 155987584
(4S,5S)-5-(2-fluorophenoxy)-1-[(3-methyl-2-pyridinyl)methyl]azepan-4-ol (PubChem CID 155987584) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is (4S,5S)-5-(2-fluorophenoxy)-1-[(3-methyl-2-pyridinyl)methyl]azepan-4-ol.
| Compound Name | (4S,5S)-5-(2-fluorophenoxy)-1-[(3-methyl-2-pyridinyl)methyl]azepan-4-ol |
|---|---|
| PubChem CID | 155987584 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (4S,5S)-5-(2-fluorophenoxy)-1-[(3-methyl-2-pyridinyl)methyl]azepan-4-ol |
| SMILES | Cc1cccnc1CN1CC[C@H](Oc2ccccc2F)[C@@H](O)CC1 |
| InChI | InChI=1S/C19H23FN2O2/c1-14-5-4-10-21-16(14)13-22-11-8-17(23)19(9-12-22)24-18-7-3-2-6-15(18)20/h2-7,10,17,19,23H,8-9,11-13H2,1H3/t17-,19-/m0/s1 |
| InChIKey | NMURECVQZGEKCV-HKUYNNGSSA-N |
| XLogP | 2.93 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |