C17H22N2O2S — CID 110128622
(4S,5S)-5-[(2-methyl-3-pyridinyl)oxy]-1-(thiophen-3-ylmethyl)azepan-4-ol (PubChem CID 110128622) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is (4S,5S)-5-[(2-methyl-3-pyridinyl)oxy]-1-(thiophen-3-ylmethyl)azepan-4-ol.
| Compound Name | (4S,5S)-5-[(2-methyl-3-pyridinyl)oxy]-1-(thiophen-3-ylmethyl)azepan-4-ol |
|---|---|
| PubChem CID | 110128622 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (4S,5S)-5-[(2-methyl-3-pyridinyl)oxy]-1-(thiophen-3-ylmethyl)azepan-4-ol |
| SMILES | Cc1ncccc1O[C@H]1CCN(Cc2ccsc2)CC[C@@H]1O |
| InChI | InChI=1S/C17H22N2O2S/c1-13-16(3-2-7-18-13)21-17-5-9-19(8-4-15(17)20)11-14-6-10-22-12-14/h2-3,6-7,10,12,15,17,20H,4-5,8-9,11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | UESRVXORLOYFNS-RDJZCZTQSA-N |
| XLogP | 2.86 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |