C17H20FNO2S — CID 110128621
(4S,5S)-5-(2-fluorophenoxy)-1-(thiophen-3-ylmethyl)azepan-4-ol (PubChem CID 110128621) has the molecular formula C17H20FNO2S and a molecular weight of 321.42 g/mol. Its IUPAC name is (4S,5S)-5-(2-fluorophenoxy)-1-(thiophen-3-ylmethyl)azepan-4-ol.
| Compound Name | (4S,5S)-5-(2-fluorophenoxy)-1-(thiophen-3-ylmethyl)azepan-4-ol |
|---|---|
| PubChem CID | 110128621 |
| Molecular Formula | C17H20FNO2S |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (4S,5S)-5-(2-fluorophenoxy)-1-(thiophen-3-ylmethyl)azepan-4-ol |
| SMILES | O[C@H]1CCN(Cc2ccsc2)CC[C@@H]1Oc1ccccc1F |
| InChI | InChI=1S/C17H20FNO2S/c18-14-3-1-2-4-16(14)21-17-6-9-19(8-5-15(17)20)11-13-7-10-22-12-13/h1-4,7,10,12,15,17,20H,5-6,8-9,11H2/t15-,17-/m0/s1 |
| InChIKey | ULKAFLACCSCOIO-RDJZCZTQSA-N |
| XLogP | 3.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |